Products 2738381-47-8
CAS 2738381-47-8 is the registry number for Anti-infective agent 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-nitro-7-[(4-pyridin-3-ylphenyl)methyl]imidazo[1,2-a]pyrazin-8-one (CAS 2738381-47-8) is a chemical compound with the molecular formula C18H13N5O3 and a molecular weight of 347.3 g/mol. IUPAC name: 2-nitro-7-[(4-pyridin-3-ylphenyl)methyl]imidazo[1,2-a]pyrazin-8-one. InChIKey: RYMURFCZKNEFRQ-UHFFFAOYSA-N.
| Molecular formula | C18H13N5O3 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | 2-nitro-7-[(4-pyridin-3-ylphenyl)methyl]imidazo[1,2-a]pyrazin-8-one |
| InChIKey | RYMURFCZKNEFRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC=C(C=C2)CN3C=CN4C=C(N=C4C3=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Anti-infective agent 5, orb1688881