Products 2738381-52-5
CAS 2738381-52-5 is the registry number for Anti-infective agent 4. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-nitro-7-[[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]methyl]imidazo[1,2-a]pyrazin-8-one (CAS 2738381-52-5) is a chemical compound with the molecular formula C19H12F3N5O4 and a molecular weight of 431.3 g/mol. IUPAC name: 2-nitro-7-[[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]methyl]imidazo[1,2-a]pyrazin-8-one. InChIKey: YGQBEUJUYKJJEB-UHFFFAOYSA-N.
| Molecular formula | C19H12F3N5O4 |
|---|---|
| Molecular weight | 431.3 g/mol |
| IUPAC name | 2-nitro-7-[[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]methyl]imidazo[1,2-a]pyrazin-8-one |
| InChIKey | YGQBEUJUYKJJEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(C=C2)CN3C=CN4C=C(N=C4C3=O)[N+](=O)[O-])OC(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Anti-infective agent 4, orb1687643