CAS 2738870-37-4 is the registry number for 2-(Methylthio)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4(1H)-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylsulfanyl-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one;hydrochloride (CAS 2738870-37-4) is a chemical compound with the molecular formula C8H12ClN3OS and a molecular weight of 233.72 g/mol. IUPAC name: 2-methylsulfanyl-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one;hydrochloride. InChIKey: LDYYIGOKOKFIAG-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3OS |
|---|---|
| Molecular weight | 233.72 g/mol |
| IUPAC name | 2-methylsulfanyl-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one;hydrochloride |
| InChIKey | LDYYIGOKOKFIAG-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(CCNC2)C(=O)N1.Cl |
Computed by PubChem (NCBI)