CAS 2738980-89-5 is the registry number for 4-Chloro-3,5-difluoro-2-nitropyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3,5-difluoro-2-nitropyridine (CAS 2738980-89-5) is a chemical compound with the molecular formula C5HClF2N2O2 and a molecular weight of 194.52 g/mol. IUPAC name: 4-chloro-3,5-difluoro-2-nitropyridine. InChIKey: VQIZOKBRRQMBOS-UHFFFAOYSA-N.
| Molecular formula | C5HClF2N2O2 |
|---|---|
| Molecular weight | 194.52 g/mol |
| IUPAC name | 4-chloro-3,5-difluoro-2-nitropyridine |
| InChIKey | VQIZOKBRRQMBOS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)[N+](=O)[O-])F)Cl)F |
Computed by PubChem (NCBI)