CAS 2740304-36-1 appears in our catalog under these names: 2,4-Difluoro U-48800 Hydrochloride, 2,4-Difluoro U-48800 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 5 mg, 1 mg.
2-(2,4-difluorophenyl)-N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-methylacetamide;hydrochloride (CAS 2740304-36-1) is a chemical compound with the molecular formula C17H25ClF2N2O and a molecular weight of 346.8 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-methylacetamide;hydrochloride. InChIKey: QNIXOIRJLOXTHO-QNBGGDODSA-N.
| Molecular formula | C17H25ClF2N2O |
|---|---|
| Molecular weight | 346.8 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-methylacetamide;hydrochloride |
| InChIKey | QNIXOIRJLOXTHO-QNBGGDODSA-N |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1N(C)C(=O)CC2=C(C=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)