CAS 2740402-74-6 appears in our catalog under these names: Hydroxychloroquine O–Sulfate (sodium salt), Hydroxychloroquine O-sulfate (sodium). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
Sodium 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethyl sulfate (CAS 2740402-74-6) is a chemical compound with the molecular formula C18H25ClN3NaO4S and a molecular weight of 437.9 g/mol. IUPAC name: sodium 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethyl sulfate. InChIKey: DXNDPIWJQPZOPR-UHFFFAOYSA-M.
| Molecular formula | C18H25ClN3NaO4S |
|---|---|
| Molecular weight | 437.9 g/mol |
| IUPAC name | sodium 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethyl sulfate |
| InChIKey | DXNDPIWJQPZOPR-UHFFFAOYSA-M |
| SMILES | CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCOS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)