CAS 2740411-96-3 appears in our catalog under these names: 2,6-Dichloro-3-fluoro-5-nitropyridine, 98%, 2,6-Dichloro-3-fluoro-5-nitropyridine, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g, 100mg, 250mg.
2,6-dichloro-3-fluoro-5-nitropyridine (CAS 2740411-96-3) is a chemical compound with the molecular formula C5HCl2FN2O2 and a molecular weight of 210.97 g/mol. IUPAC name: 2,6-dichloro-3-fluoro-5-nitropyridine. InChIKey: LHONCJSOLHBCNA-UHFFFAOYSA-N.
| Molecular formula | C5HCl2FN2O2 |
|---|---|
| Molecular weight | 210.97 g/mol |
| IUPAC name | 2,6-dichloro-3-fluoro-5-nitropyridine |
| InChIKey | LHONCJSOLHBCNA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1F)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)