CAS 2740592-82-7 appears in our catalog under these names: (S)-1-(Oxetan-3-yl)piperidin-3-amine hemioxalate, 97%, (S)-1-(Oxetan-3-yl)piperidin-3-amine hemioxalate, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
Oxalic acid;bis((3S)-1-(oxetan-3-yl)piperidin-3-amine) (CAS 2740592-82-7) is a chemical compound with the molecular formula C18H34N4O6 and a molecular weight of 402.5 g/mol. IUPAC name: oxalic acid;bis((3S)-1-(oxetan-3-yl)piperidin-3-amine). InChIKey: UUIXPYKVXYWHGZ-UBKPKTQASA-N.
| Molecular formula | C18H34N4O6 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | oxalic acid;bis((3S)-1-(oxetan-3-yl)piperidin-3-amine) |
| InChIKey | UUIXPYKVXYWHGZ-UBKPKTQASA-N |
| SMILES | C1C[C@@H](CN(C1)C2COC2)N.C1C[C@@H](CN(C1)C2COC2)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)