CAS 2740657-29-6 is the registry number for Desamino lenalidomide-4-Br-7-OH. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(7-bromo-4-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2740657-29-6) is a chemical compound with the molecular formula C13H11BrN2O4 and a molecular weight of 339.14 g/mol. IUPAC name: 3-(7-bromo-4-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: WXLNCBKINKQYOU-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O4 |
|---|---|
| Molecular weight | 339.14 g/mol |
| IUPAC name | 3-(7-bromo-4-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | WXLNCBKINKQYOU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C=CC(=C3C2=O)O)Br |
Computed by PubChem (NCBI)