CAS 2741265-19-8 is the registry number for Isoquinolin-7-yldimethylphosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-dimethylphosphorylisoquinoline (CAS 2741265-19-8) is a chemical compound with the molecular formula C11H12NOP and a molecular weight of 205.19 g/mol. IUPAC name: 7-dimethylphosphorylisoquinoline. InChIKey: NRZPEMPSRNHDOP-UHFFFAOYSA-N.
| Molecular formula | C11H12NOP |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 7-dimethylphosphorylisoquinoline |
| InChIKey | NRZPEMPSRNHDOP-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC2=C(C=C1)C=CN=C2 |
Computed by PubChem (NCBI)