Products 2741380-71-0
CAS 2741380-71-0 appears in our catalog under these names: Ambroxol–d5 (hydrochloride), Ambroxol-d5 (hydrochloride), 99%, 99%, Ambroxol-d5 (hydrochloride), 99.61%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 500μg, 1 mg, 500 μg.
4-[(2-amino-3,5-dibromophenyl)methylamino]-1,2,2,6,6-pentadeuteriocyclohexan-1-ol;hydrochloride (CAS 2741380-71-0) is a chemical compound with the molecular formula C13H19Br2ClN2O and a molecular weight of 419.59 g/mol. IUPAC name: 4-[(2-amino-3,5-dibromophenyl)methylamino]-1,2,2,6,6-pentadeuteriocyclohexan-1-ol;hydrochloride. InChIKey: QNVKOSLOVOTXKF-LIZULUGVSA-N.
| Molecular formula | C13H19Br2ClN2O |
|---|---|
| Molecular weight | 419.59 g/mol |
| IUPAC name | 4-[(2-amino-3,5-dibromophenyl)methylamino]-1,2,2,6,6-pentadeuteriocyclohexan-1-ol;hydrochloride |
| InChIKey | QNVKOSLOVOTXKF-LIZULUGVSA-N |
| SMILES | [2H]C1(CC(CC(C1([2H])O)([2H])[2H])NCC2=C(C(=CC(=C2)Br)Br)N)[2H].Cl |
Computed by PubChem (NCBI)