CAS 27414-57-9 is the registry number for Dichloro-[2,2]-paracyclophane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5,12-dichlorotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene (CAS 27414-57-9) is a chemical compound with the molecular formula C16H14Cl2 and a molecular weight of 277.2 g/mol. IUPAC name: 5,12-dichlorotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene. InChIKey: KAWOYOQFRXSZQI-UHFFFAOYSA-N.
| Molecular formula | C16H14Cl2 |
|---|---|
| Molecular weight | 277.2 g/mol |
| IUPAC name | 5,12-dichlorotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
| InChIKey | KAWOYOQFRXSZQI-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(CCC3=C(C=C1C=C3)Cl)C=C2)Cl |
Computed by PubChem (NCBI)