CAS 27414-69-3 is the registry number for Indigo Carmine Related Compound 1. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 3-hydroxy-2-(3-oxoindol-2-yl)-1H-indole-5-sulfonate (CAS 27414-69-3) is a chemical compound with the molecular formula C16H9N2NaO5S and a molecular weight of 364.3 g/mol. IUPAC name: sodium 3-hydroxy-2-(3-oxoindol-2-yl)-1H-indole-5-sulfonate. InChIKey: NLCACJFXVQGNOU-UHFFFAOYSA-M.
| Molecular formula | C16H9N2NaO5S |
|---|---|
| Molecular weight | 364.3 g/mol |
| IUPAC name | sodium 3-hydroxy-2-(3-oxoindol-2-yl)-1H-indole-5-sulfonate |
| InChIKey | NLCACJFXVQGNOU-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=N2)C3=C(C4=C(N3)C=CC(=C4)S(=O)(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)