CAS 2741464-26-4 is the registry number for Cyclopent-3-enecarboxamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]-3-hydroxy-2-nitrobenzamide (CAS 2741464-26-4) is a chemical compound with the molecular formula C31H50N2O6Si2 and a molecular weight of 602.9 g/mol. IUPAC name: N-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]-3-hydroxy-2-nitrobenzamide. InChIKey: SWADPRVLXADONQ-UHFFFAOYSA-N.
| Molecular formula | C31H50N2O6Si2 |
|---|---|
| Molecular weight | 602.9 g/mol |
| IUPAC name | N-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]-3-hydroxy-2-nitrobenzamide |
| InChIKey | SWADPRVLXADONQ-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)OC1=CC(=CC(=C1)NC(=O)C2=C(C(=CC=C2)O)[N+](=O)[O-])O[Si](C(C)C)(C(C)C)C(C)C |
Computed by PubChem (NCBI)