CAS 2741884-03-5 appears in our catalog under these names: Phenyl U–47700 (hydrochloride), Phenyl U-47700 Hydrochloride. Offered by: GLPBio, TRC. Available pack sizes: 5mg, 500mg, 1mg.
3,4-dichloro-N-[(1S,2S)-2-(dimethylamino)cyclohexyl]-N-phenylbenzamide;hydrochloride (CAS 2741884-03-5) is a chemical compound with the molecular formula C21H25Cl3N2O and a molecular weight of 427.8 g/mol. IUPAC name: 3,4-dichloro-N-[(1S,2S)-2-(dimethylamino)cyclohexyl]-N-phenylbenzamide;hydrochloride. InChIKey: FEJRKQJZGRLLBG-FKLPMGAJSA-N.
| Molecular formula | C21H25Cl3N2O |
|---|---|
| Molecular weight | 427.8 g/mol |
| IUPAC name | 3,4-dichloro-N-[(1S,2S)-2-(dimethylamino)cyclohexyl]-N-phenylbenzamide;hydrochloride |
| InChIKey | FEJRKQJZGRLLBG-FKLPMGAJSA-N |
| SMILES | CN(C)[C@H]1CCCC[C@@H]1N(C2=CC=CC=C2)C(=O)C3=CC(=C(C=C3)Cl)Cl.Cl |
Computed by PubChem (NCBI)