Products 2743442-69-3
CAS 2743442-69-3 is the registry number for 5-azaspiro[2.5]octan-8-one, trifluoroacetic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
5-azaspiro[2.5]octan-8-one;2,2,2-trifluoroacetic acid (CAS 2743442-69-3) is a chemical compound with the molecular formula C9H12F3NO3 and a molecular weight of 239.19 g/mol. IUPAC name: 5-azaspiro[2.5]octan-8-one;2,2,2-trifluoroacetic acid. InChIKey: FDKXCWMQQVSOBM-UHFFFAOYSA-N.
| Molecular formula | C9H12F3NO3 |
|---|---|
| Molecular weight | 239.19 g/mol |
| IUPAC name | 5-azaspiro[2.5]octan-8-one;2,2,2-trifluoroacetic acid |
| InChIKey | FDKXCWMQQVSOBM-UHFFFAOYSA-N |
| SMILES | C1CNCC2(C1=O)CC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)