CAS 2743490-12-0 is the registry number for 2-(3-Fluorophenyl)-2H-tetrazol-5-amine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3-fluorophenyl)tetrazol-5-amine (CAS 2743490-12-0) is a chemical compound with the molecular formula C7H6FN5 and a molecular weight of 179.15 g/mol. IUPAC name: 2-(3-fluorophenyl)tetrazol-5-amine. InChIKey: QDXWMZLSUNLFDC-UHFFFAOYSA-N.
| Molecular formula | C7H6FN5 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 2-(3-fluorophenyl)tetrazol-5-amine |
| InChIKey | QDXWMZLSUNLFDC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N2N=C(N=N2)N |
Computed by PubChem (NCBI)