CAS 1247241-42-4 is the registry number for 3-Fluoro-4-(1H-1,2,3,4-tetrazol-1-yl)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-fluoro-4-(tetrazol-1-yl)aniline (CAS 1247241-42-4) is a chemical compound with the molecular formula C7H6FN5 and a molecular weight of 179.15 g/mol. IUPAC name: 3-fluoro-4-(tetrazol-1-yl)aniline. InChIKey: KEPYOHGQCARXKC-UHFFFAOYSA-N.
| Molecular formula | C7H6FN5 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 3-fluoro-4-(tetrazol-1-yl)aniline |
| InChIKey | KEPYOHGQCARXKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)F)N2C=NN=N2 |
Computed by PubChem (NCBI)