CAS 2744-50-5 appears in our catalog under these names: Diisobutyl Perylenedicarboxylate (mixture of regioisomers), Diisobutyl Perylenedicarboxylate (mixture of regioisomers), >98.0%(HPLC), Diisobutyl perylene-3,9-dicarboxylate, 95% (mixture of regioisomers), 95% (mixture of regioisomers), Diisobutyl perylene-3,9-dicarboxylate, 97%(mixture of regioisomers), Diisobutyl perylene-3,9-dicarboxylate 95% (mixture of regioisomers). Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 100g, 500g, 1000g, 10g, 1kg.
Bis(2-methylpropyl) perylene-3,9-dicarboxylate (CAS 2744-50-5) is a chemical compound with the molecular formula C30H28O4 and a molecular weight of 452.5 g/mol. IUPAC name: bis(2-methylpropyl) perylene-3,9-dicarboxylate. InChIKey: YLNJGHNUXCVDIX-UHFFFAOYSA-N.
| Molecular formula | C30H28O4 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | bis(2-methylpropyl) perylene-3,9-dicarboxylate |
| InChIKey | YLNJGHNUXCVDIX-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)C1=CC=C2C3=C4C(=CC=C3)C(=CC=C4C5=C2C1=CC=C5)C(=O)OCC(C)C |
Computed by PubChem (NCBI)