CAS 2744168-51-0 appears in our catalog under these names: CYP11A1-IN-1, CYP11A1–IN–1, CYP11A1-IN-1, 99%, 99%, CYP11A1-IN-1, 98.90%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 100 mg, 5 mg.
Tert-butyl 6-[[6-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4-oxopyran-3-yl]oxymethyl]-2-azaspiro[3.3]heptane-2-carboxylate (CAS 2744168-51-0) is a chemical compound with the molecular formula C27H34N2O5 and a molecular weight of 466.6 g/mol. IUPAC name: tert-butyl 6-[[6-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4-oxopyran-3-yl]oxymethyl]-2-azaspiro[3.3]heptane-2-carboxylate. InChIKey: FYDVRTQEHDKFTK-UHFFFAOYSA-N.
| Molecular formula | C27H34N2O5 |
|---|---|
| Molecular weight | 466.6 g/mol |
| IUPAC name | tert-butyl 6-[[6-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4-oxopyran-3-yl]oxymethyl]-2-azaspiro[3.3]heptane-2-carboxylate |
| InChIKey | FYDVRTQEHDKFTK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)COC3=COC(=CC3=O)CN4CCC5=CC=CC=C5C4 |
Computed by PubChem (NCBI)