CAS 2744280-76-8 appears in our catalog under these names: Empagliflozin Impurity 186, (S)-3-(2-(5-Bromo-2-chlorobenzyl)phenoxy)tetrahydrofuran, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-[2-[(5-bromo-2-chlorophenyl)methyl]phenoxy]oxolane (CAS 2744280-76-8) is a chemical compound with the molecular formula C17H16BrClO2 and a molecular weight of 367.7 g/mol. IUPAC name: (3S)-3-[2-[(5-bromo-2-chlorophenyl)methyl]phenoxy]oxolane. InChIKey: KIIUBQNMMICEJJ-HNNXBMFYSA-N.
| Molecular formula | C17H16BrClO2 |
|---|---|
| Molecular weight | 367.7 g/mol |
| IUPAC name | (3S)-3-[2-[(5-bromo-2-chlorophenyl)methyl]phenoxy]oxolane |
| InChIKey | KIIUBQNMMICEJJ-HNNXBMFYSA-N |
| SMILES | C1COC[C@H]1OC2=CC=CC=C2CC3=C(C=CC(=C3)Br)Cl |
Computed by PubChem (NCBI)