CAS 27452-14-8 is the registry number for 6-Chloro-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-chloro-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (CAS 27452-14-8) is a chemical compound with the molecular formula C14H19Cl and a molecular weight of 222.75 g/mol. IUPAC name: 6-chloro-1,1,4,4-tetramethyl-2,3-dihydronaphthalene. InChIKey: XGCVHZKLKNAWIE-UHFFFAOYSA-N.
| Molecular formula | C14H19Cl |
|---|---|
| Molecular weight | 222.75 g/mol |
| IUPAC name | 6-chloro-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| InChIKey | XGCVHZKLKNAWIE-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)Cl)(C)C)C |
Computed by PubChem (NCBI)