CAS 2747-91-3 appears in our catalog under these names: Cadaverine-15N2 DiHCl, Cadaverine-15N2 Dihydrochloride, >95% (HPLC), Cadaverine-15N2 dihydrochloride, Pentane-1,5-diamine-15N2 (dihydrochloride). Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 10mg, 1mg, 2mg, 5mg, 2.5 mg.
Pentane-1,5-di(15N2)amine;dihydrochloride (CAS 2747-91-3) is a chemical compound with the molecular formula C5H16Cl2N2 and a molecular weight of 177.08 g/mol. IUPAC name: pentane-1,5-di(15N2)amine;dihydrochloride. InChIKey: FGNLEIGUMSBZQP-SGHMELATSA-N.
| Molecular formula | C5H16Cl2N2 |
|---|---|
| Molecular weight | 177.08 g/mol |
| IUPAC name | pentane-1,5-di(15N2)amine;dihydrochloride |
| InChIKey | FGNLEIGUMSBZQP-SGHMELATSA-N |
| SMILES | C(CC[15NH2])CC[15NH2].Cl.Cl |
Computed by PubChem (NCBI)