Products 2747283-69-6
CAS 2747283-69-6 is the registry number for tert-Butyl 2-(7-chlorothieno[3,2-b]pyridin-3-yl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-(7-chlorothieno[3,2-b]pyridin-3-yl)acetate (CAS 2747283-69-6) is a chemical compound with the molecular formula C13H14ClNO2S and a molecular weight of 283.77 g/mol. IUPAC name: tert-butyl 2-(7-chlorothieno[3,2-b]pyridin-3-yl)acetate. InChIKey: KTKWEXKYAVBNCU-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO2S |
|---|---|
| Molecular weight | 283.77 g/mol |
| IUPAC name | tert-butyl 2-(7-chlorothieno[3,2-b]pyridin-3-yl)acetate |
| InChIKey | KTKWEXKYAVBNCU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=CSC2=C(C=CN=C12)Cl |
Computed by PubChem (NCBI)