CAS 27475-26-9 is the registry number for Methyl 5-(2-(Benzyl(tert-butyl)amino)acetyl)-2-hydroxybenzoate Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg.
Methyl 5-[2-[benzyl(tert-butyl)amino]acetyl]-2-hydroxybenzoate;hydrochloride (CAS 27475-26-9) is a chemical compound with the molecular formula C21H26ClNO4 and a molecular weight of 391.9 g/mol. IUPAC name: methyl 5-[2-[benzyl(tert-butyl)amino]acetyl]-2-hydroxybenzoate;hydrochloride. InChIKey: YTGVQSTWQRUSSJ-UHFFFAOYSA-N.
| Molecular formula | C21H26ClNO4 |
|---|---|
| Molecular weight | 391.9 g/mol |
| IUPAC name | methyl 5-[2-[benzyl(tert-butyl)amino]acetyl]-2-hydroxybenzoate;hydrochloride |
| InChIKey | YTGVQSTWQRUSSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N(CC1=CC=CC=C1)CC(=O)C2=CC(=C(C=C2)O)C(=O)OC.Cl |
Computed by PubChem (NCBI)