CAS 2747887-41-6 is the registry number for Potassium (4,4-dimethylcyclohexyl)trifluoroboranuide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Potassium (4,4-dimethylcyclohexyl)-trifluoroboranuide (CAS 2747887-41-6) is a chemical compound with the molecular formula C8H15BF3K and a molecular weight of 218.11 g/mol. IUPAC name: potassium (4,4-dimethylcyclohexyl)-trifluoroboranuide. InChIKey: JVQKKRLAMOZHQH-UHFFFAOYSA-N.
| Molecular formula | C8H15BF3K |
|---|---|
| Molecular weight | 218.11 g/mol |
| IUPAC name | potassium (4,4-dimethylcyclohexyl)-trifluoroboranuide |
| InChIKey | JVQKKRLAMOZHQH-UHFFFAOYSA-N |
| SMILES | [B-](C1CCC(CC1)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)