CAS 2747928-27-2 is the registry number for SSTR4 agonist 4. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
N-[2-(1,7-dimethylindazol-3-yl)propan-2-yl]-1-methyl-3-azabicyclo[3.1.0]hexane-6-carboxamide (CAS 2747928-27-2) is a chemical compound with the molecular formula C19H26N4O and a molecular weight of 326.4 g/mol. IUPAC name: N-[2-(1,7-dimethylindazol-3-yl)propan-2-yl]-1-methyl-3-azabicyclo[3.1.0]hexane-6-carboxamide. InChIKey: SDEPJAJKFSLDGC-UHFFFAOYSA-N.
| Molecular formula | C19H26N4O |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | N-[2-(1,7-dimethylindazol-3-yl)propan-2-yl]-1-methyl-3-azabicyclo[3.1.0]hexane-6-carboxamide |
| InChIKey | SDEPJAJKFSLDGC-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=NN2C)C(C)(C)NC(=O)C3C4C3(CNC4)C |
Computed by PubChem (NCBI)