CAS 2747990-79-8 is the registry number for Ticarcillin Sodium EP Impurity E (Mixture of Diastereomers). Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-2-[[(2-carboxy-2-thiophen-3-ylacetyl)amino]methyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (CAS 2747990-79-8) is a chemical compound with the molecular formula C14H18N2O5S2 and a molecular weight of 358.4 g/mol. IUPAC name: (4S)-2-[[(2-carboxy-2-thiophen-3-ylacetyl)amino]methyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: KWZDFBNRLLSPAZ-RTBKNWGFSA-N.
| Molecular formula | C14H18N2O5S2 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (4S)-2-[[(2-carboxy-2-thiophen-3-ylacetyl)amino]methyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | KWZDFBNRLLSPAZ-RTBKNWGFSA-N |
| SMILES | CC1([C@@H](NC(S1)CNC(=O)C(C2=CSC=C2)C(=O)O)C(=O)O)C |
Computed by PubChem (NCBI)