Products 2748155-93-1
CAS 2748155-93-1 appears in our catalog under these names: ADB–BINACA, ADB-BINACA. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-benzylindazole-3-carboxamide (CAS 2748155-93-1) is a chemical compound with the molecular formula C21H24N4O2 and a molecular weight of 364.4 g/mol. IUPAC name: N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-benzylindazole-3-carboxamide. InChIKey: IUFIUAWRCUVUCQ-UHFFFAOYSA-N.
| Molecular formula | C21H24N4O2 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-benzylindazole-3-carboxamide |
| InChIKey | IUFIUAWRCUVUCQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)N)NC(=O)C1=NN(C2=CC=CC=C21)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)