CAS 2682867-56-5 is the registry number for APP–BUTINACA. Offered by: GLPBio. Available pack sizes: 5mg, 1mg.
N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-butylindazole-3-carboxamide (CAS 2682867-56-5) is a chemical compound with the molecular formula C21H24N4O2 and a molecular weight of 364.4 g/mol. IUPAC name: N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-butylindazole-3-carboxamide. InChIKey: OYARCJMQMAFMTG-KRWDZBQOSA-N.
| Molecular formula | C21H24N4O2 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-butylindazole-3-carboxamide |
| InChIKey | OYARCJMQMAFMTG-KRWDZBQOSA-N |
| SMILES | CCCCN1C2=CC=CC=C2C(=N1)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N |
Computed by PubChem (NCBI)