CAS 27483-18-7 is the registry number for Cyclo(D-Val-L-Pro). Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,8aS)-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (CAS 27483-18-7) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: (3R,8aS)-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione. InChIKey: XLUAWXQORJEMBD-JGVFFNPUSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | (3R,8aS)-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| InChIKey | XLUAWXQORJEMBD-JGVFFNPUSA-N |
| SMILES | CC(C)[C@@H]1C(=O)N2CCC[C@H]2C(=O)N1 |
Computed by PubChem (NCBI)