Products 2748343-63-5
CAS 2748343-63-5 is the registry number for Propofol sulfate (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium [2,6-di(propan-2-yl)phenyl] sulfate (CAS 2748343-63-5) is a chemical compound with the molecular formula C12H17NaO4S and a molecular weight of 280.32 g/mol. IUPAC name: sodium [2,6-di(propan-2-yl)phenyl] sulfate. InChIKey: HWROCHTUCLVXNZ-UHFFFAOYSA-M.
| Molecular formula | C12H17NaO4S |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | sodium [2,6-di(propan-2-yl)phenyl] sulfate |
| InChIKey | HWROCHTUCLVXNZ-UHFFFAOYSA-M |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)