CAS 2748561-60-4 appears in our catalog under these names: 4–methoxy–α–Pyrrolidinopropiophenone (tosylate), 4-Methoxy-α-pyrrolidinopropiophenone (tosylate). Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 50mg, 10 mg, 5 mg, 50 mg, 25 mg.
1-(4-methoxyphenyl)-2-pyrrolidin-1-ylpropan-1-one;4-methylbenzenesulfonic acid (CAS 2748561-60-4) is a chemical compound with the molecular formula C21H27NO5S and a molecular weight of 405.5 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2-pyrrolidin-1-ylpropan-1-one;4-methylbenzenesulfonic acid. InChIKey: CSJVRHXBQZGMEL-UHFFFAOYSA-N.
| Molecular formula | C21H27NO5S |
|---|---|
| Molecular weight | 405.5 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2-pyrrolidin-1-ylpropan-1-one;4-methylbenzenesulfonic acid |
| InChIKey | CSJVRHXBQZGMEL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC(C(=O)C1=CC=C(C=C1)OC)N2CCCC2 |
Computed by PubChem (NCBI)