Products 2748673-86-9
CAS 2748673-86-9 is the registry number for WES-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2-methyl-6-(4-methylphenyl)-3-pyridinyl]-3-(2-sulfamoylphenyl)urea (CAS 2748673-86-9) is a chemical compound with the molecular formula C20H20N4O3S and a molecular weight of 396.5 g/mol. IUPAC name: 1-[2-methyl-6-(4-methylphenyl)-3-pyridinyl]-3-(2-sulfamoylphenyl)urea. InChIKey: BHEXZFRNIHDPAK-UHFFFAOYSA-N.
| Molecular formula | C20H20N4O3S |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | 1-[2-methyl-6-(4-methylphenyl)-3-pyridinyl]-3-(2-sulfamoylphenyl)urea |
| InChIKey | BHEXZFRNIHDPAK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=C(C=C2)NC(=O)NC3=CC=CC=C3S(=O)(=O)N)C |
Computed by PubChem (NCBI)