CAS 2748705-69-1 is the registry number for Maxi-K modulator 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(5-chloro-2-methoxyphenyl)-3-methyl-6-(trifluoromethyl)-1H-indol-2-one (CAS 2748705-69-1) is a chemical compound with the molecular formula C17H13ClF3NO2 and a molecular weight of 355.7 g/mol. IUPAC name: 3-(5-chloro-2-methoxyphenyl)-3-methyl-6-(trifluoromethyl)-1H-indol-2-one. InChIKey: QVYLWRUVHNJFCE-UHFFFAOYSA-N.
| Molecular formula | C17H13ClF3NO2 |
|---|---|
| Molecular weight | 355.7 g/mol |
| IUPAC name | 3-(5-chloro-2-methoxyphenyl)-3-methyl-6-(trifluoromethyl)-1H-indol-2-one |
| InChIKey | QVYLWRUVHNJFCE-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)C(F)(F)F)NC1=O)C3=C(C=CC(=C3)Cl)OC |
Computed by PubChem (NCBI)