Products 274925-86-9
CAS 274925-86-9 appears in our catalog under these names: Nebicapone, Nebicapone, 99.89%, Nebicapone (Standard), Nebicapone, 99.61%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 25 mg, 100 mg, 50 mg.
1-(3,4-dihydroxy-5-nitrophenyl)-2-phenylethanone (CAS 274925-86-9) is a chemical compound with the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. IUPAC name: 1-(3,4-dihydroxy-5-nitrophenyl)-2-phenylethanone. InChIKey: MRFOLGFFTUGAEB-UHFFFAOYSA-N.
| Molecular formula | C14H11NO5 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | 1-(3,4-dihydroxy-5-nitrophenyl)-2-phenylethanone |
| InChIKey | MRFOLGFFTUGAEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=CC(=C(C(=C2)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)