CAS 2749298-55-1 is the registry number for N–desmethyl AH 7921 (hydrochloride). Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
3,4-dichloro-N-[[1-(methylamino)cyclohexyl]methyl]benzamide;hydrochloride (CAS 2749298-55-1) is a chemical compound with the molecular formula C15H21Cl3N2O and a molecular weight of 351.7 g/mol. IUPAC name: 3,4-dichloro-N-[[1-(methylamino)cyclohexyl]methyl]benzamide;hydrochloride. InChIKey: ZYEJHUPWOHWUGD-UHFFFAOYSA-N.
| Molecular formula | C15H21Cl3N2O |
|---|---|
| Molecular weight | 351.7 g/mol |
| IUPAC name | 3,4-dichloro-N-[[1-(methylamino)cyclohexyl]methyl]benzamide;hydrochloride |
| InChIKey | ZYEJHUPWOHWUGD-UHFFFAOYSA-N |
| SMILES | CNC1(CCCCC1)CNC(=O)C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)