CAS 2749316-95-6 is the registry number for RCS–4–d9 (exempt preparation). Offered by: GLPBio. Available pack sizes: 1mg.
(4-methoxyphenyl)-[1-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)indol-3-yl]methanone (CAS 2749316-95-6) is a chemical compound with the molecular formula C21H23NO2 and a molecular weight of 330.5 g/mol. IUPAC name: (4-methoxyphenyl)-[1-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)indol-3-yl]methanone. InChIKey: OZCYJKDWRUIFFE-KBUIAFKWSA-N.
| Molecular formula | C21H23NO2 |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | (4-methoxyphenyl)-[1-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)indol-3-yl]methanone |
| InChIKey | OZCYJKDWRUIFFE-KBUIAFKWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])CN1C=C(C2=CC=CC=C21)C(=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)