CAS 2749433-76-7 is the registry number for Propyl U–47700. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
3,4-dichloro-N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-propylbenzamide (CAS 2749433-76-7) is a chemical compound with the molecular formula C18H26Cl2N2O and a molecular weight of 357.3 g/mol. IUPAC name: 3,4-dichloro-N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-propylbenzamide. InChIKey: ONTPYMHHQOSZRB-IAGOWNOFSA-N.
| Molecular formula | C18H26Cl2N2O |
|---|---|
| Molecular weight | 357.3 g/mol |
| IUPAC name | 3,4-dichloro-N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-propylbenzamide |
| InChIKey | ONTPYMHHQOSZRB-IAGOWNOFSA-N |
| SMILES | CCCN([C@@H]1CCCC[C@H]1N(C)C)C(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)