Products 2749504-71-8
CAS 2749504-71-8 is the registry number for 4-CIC (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
1-(4-chlorophenyl)-2-(propan-2-ylamino)propan-1-one;hydrochloride (CAS 2749504-71-8) is a chemical compound with the molecular formula C12H17Cl2NO and a molecular weight of 262.17 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-(propan-2-ylamino)propan-1-one;hydrochloride. InChIKey: URFYERZPSWPDDJ-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2NO |
|---|---|
| Molecular weight | 262.17 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-(propan-2-ylamino)propan-1-one;hydrochloride |
| InChIKey | URFYERZPSWPDDJ-UHFFFAOYSA-N |
| SMILES | CC(C)NC(C)C(=O)C1=CC=C(C=C1)Cl.Cl |
Computed by PubChem (NCBI)