Products 2749554-00-3
CAS 2749554-00-3 is the registry number for DX2-201. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl (3R)-1-[4-(diethylsulfamoyl)phenyl]sulfonylpiperidine-3-carboxylate (CAS 2749554-00-3) is a chemical compound with the molecular formula C18H28N2O6S2 and a molecular weight of 432.6 g/mol. IUPAC name: ethyl (3R)-1-[4-(diethylsulfamoyl)phenyl]sulfonylpiperidine-3-carboxylate. InChIKey: YXHKYCUPYONBDS-OAHLLOKOSA-N.
| Molecular formula | C18H28N2O6S2 |
|---|---|
| Molecular weight | 432.6 g/mol |
| IUPAC name | ethyl (3R)-1-[4-(diethylsulfamoyl)phenyl]sulfonylpiperidine-3-carboxylate |
| InChIKey | YXHKYCUPYONBDS-OAHLLOKOSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)S(=O)(=O)N2CCC[C@H](C2)C(=O)OCC |
Computed by PubChem (NCBI)