CAS 2749601-05-4 is the registry number for tert-Butyl (2S,4R)-2-((1H-1,2,3-triazol-1-yl)methyl)-4-aminopyrrolidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S,4R)-4-amino-2-(triazol-1-ylmethyl)pyrrolidine-1-carboxylate (CAS 2749601-05-4) is a chemical compound with the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. IUPAC name: tert-butyl (2S,4R)-4-amino-2-(triazol-1-ylmethyl)pyrrolidine-1-carboxylate. InChIKey: MPNJYVMIPKCBLA-ZJUUUORDSA-N.
| Molecular formula | C12H21N5O2 |
|---|---|
| Molecular weight | 267.33 g/mol |
| IUPAC name | tert-butyl (2S,4R)-4-amino-2-(triazol-1-ylmethyl)pyrrolidine-1-carboxylate |
| InChIKey | MPNJYVMIPKCBLA-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1CN2C=CN=N2)N |
Computed by PubChem (NCBI)