CAS 2227686-00-0 is the registry number for tert-Butyl (2R)-2-(5-amino-1-methyl-1H-1,2,4-triazol-3-yl)pyrrolidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (2R)-2-(5-amino-1-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboxylate (CAS 2227686-00-0) is a chemical compound with the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. IUPAC name: tert-butyl (2R)-2-(5-amino-1-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboxylate. InChIKey: WSBNRKHMRURKBR-MRVPVSSYSA-N.
| Molecular formula | C12H21N5O2 |
|---|---|
| Molecular weight | 267.33 g/mol |
| IUPAC name | tert-butyl (2R)-2-(5-amino-1-methyl-1,2,4-triazol-3-yl)pyrrolidine-1-carboxylate |
| InChIKey | WSBNRKHMRURKBR-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C2=NN(C(=N2)N)C |
Computed by PubChem (NCBI)