CAS 2749638-90-0 is the registry number for KT109 N2 Regioisomer. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
(2-benzylpiperidin-1-yl)-[4-(4-phenylphenyl)triazol-2-yl]methanone (CAS 2749638-90-0) is a chemical compound with the molecular formula C27H26N4O and a molecular weight of 422.5 g/mol. IUPAC name: (2-benzylpiperidin-1-yl)-[4-(4-phenylphenyl)triazol-2-yl]methanone. InChIKey: WMCOXOOJRVMPMD-UHFFFAOYSA-N.
| Molecular formula | C27H26N4O |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | (2-benzylpiperidin-1-yl)-[4-(4-phenylphenyl)triazol-2-yl]methanone |
| InChIKey | WMCOXOOJRVMPMD-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)CC2=CC=CC=C2)C(=O)N3N=CC(=N3)C4=CC=C(C=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)