Products 2749864-49-9
CAS 2749864-49-9 is the registry number for 7,10-Dioxadispiro[3.1.46.14]undecan-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7,10-dioxadispiro[3.1.46.14]undecan-2-one (CAS 2749864-49-9) is a chemical compound with the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. IUPAC name: 7,10-dioxadispiro[3.1.46.14]undecan-2-one. InChIKey: HXRIKCSTVSUWCO-UHFFFAOYSA-N.
| Molecular formula | C9H12O3 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 7,10-dioxadispiro[3.1.46.14]undecan-2-one |
| InChIKey | HXRIKCSTVSUWCO-UHFFFAOYSA-N |
| SMILES | C1COC2(O1)CC3(C2)CC(=O)C3 |
Computed by PubChem (NCBI)