CAS 2749969-19-3 is the registry number for 3-Descarboxy-3-sulfocaetyl Olsalazine. Offered by: TRC. Available pack sizes: 250mg.
2-hydroxy-5-[[4-hydroxy-3-(2-sulfoacetyl)phenyl]diazenyl]benzoic acid (CAS 2749969-19-3) is a chemical compound with the molecular formula C15H12N2O8S and a molecular weight of 380.3 g/mol. IUPAC name: 2-hydroxy-5-[[4-hydroxy-3-(2-sulfoacetyl)phenyl]diazenyl]benzoic acid. InChIKey: GRFQCNZEHFGXRP-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O8S |
|---|---|
| Molecular weight | 380.3 g/mol |
| IUPAC name | 2-hydroxy-5-[[4-hydroxy-3-(2-sulfoacetyl)phenyl]diazenyl]benzoic acid |
| InChIKey | GRFQCNZEHFGXRP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=NC2=CC(=C(C=C2)O)C(=O)O)C(=O)CS(=O)(=O)O)O |
Computed by PubChem (NCBI)