Products 2750370-67-1
CAS 2750370-67-1 is the registry number for Apoptosis inducer 14. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-2-(1H-indole-3-carbonyl)-3-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile (CAS 2750370-67-1) is a chemical compound with the molecular formula C27H17N5O3 and a molecular weight of 459.5 g/mol. IUPAC name: (E)-2-(1H-indole-3-carbonyl)-3-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile. InChIKey: NIXVYLUYIRMMQB-XMHGGMMESA-N.
| Molecular formula | C27H17N5O3 |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | (E)-2-(1H-indole-3-carbonyl)-3-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile |
| InChIKey | NIXVYLUYIRMMQB-XMHGGMMESA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C3=CC=C(C=C3)[N+](=O)[O-])/C=C(\C#N)/C(=O)C4=CNC5=CC=CC=C54 |
Computed by PubChem (NCBI)
Synonyms:
Apoptosis inducer 14, orb3133280