CAS 27505-78-8 is the registry number for 2,3,7-Trimethyl-1H-indole, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,7-trimethyl-1H-indole (CAS 27505-78-8) is a chemical compound with the molecular formula C11H13N and a molecular weight of 159.23 g/mol. IUPAC name: 2,3,7-trimethyl-1H-indole. InChIKey: USKKDNORVCJALM-UHFFFAOYSA-N.
| Molecular formula | C11H13N |
|---|---|
| Molecular weight | 159.23 g/mol |
| IUPAC name | 2,3,7-trimethyl-1H-indole |
| InChIKey | USKKDNORVCJALM-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C(N2)C)C |
Computed by PubChem (NCBI)