CAS 2750646-98-9 is the registry number for 2,3-Difluoro-5-methoxy-1-methyl-4-(trimethylsilyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,3-difluoro-6-methoxy-4-methylphenyl)-trimethylsilane (CAS 2750646-98-9) is a chemical compound with the molecular formula C11H16F2OSi and a molecular weight of 230.33 g/mol. IUPAC name: (2,3-difluoro-6-methoxy-4-methylphenyl)-trimethylsilane. InChIKey: QPEJWIUPDQAZFQ-UHFFFAOYSA-N.
| Molecular formula | C11H16F2OSi |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | (2,3-difluoro-6-methoxy-4-methylphenyl)-trimethylsilane |
| InChIKey | QPEJWIUPDQAZFQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1F)F)[Si](C)(C)C)OC |
Computed by PubChem (NCBI)