CAS 2750707-52-7 is the registry number for 1,3-Diethyl-4,7-bis(4-formylphenyl)-1H-benzo[d]imidazol-3-ium iodide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[1,3-diethyl-7-(4-formylphenyl)benzimidazol-1-ium-4-yl]benzaldehyde iodide (CAS 2750707-52-7) is a chemical compound with the molecular formula C25H23IN2O2 and a molecular weight of 510.4 g/mol. IUPAC name: 4-[1,3-diethyl-7-(4-formylphenyl)benzimidazol-1-ium-4-yl]benzaldehyde iodide. InChIKey: RYRRVVFNFWYNGQ-UHFFFAOYSA-M.
| Molecular formula | C25H23IN2O2 |
|---|---|
| Molecular weight | 510.4 g/mol |
| IUPAC name | 4-[1,3-diethyl-7-(4-formylphenyl)benzimidazol-1-ium-4-yl]benzaldehyde iodide |
| InChIKey | RYRRVVFNFWYNGQ-UHFFFAOYSA-M |
| SMILES | CCN1C=[N+](C2=C(C=CC(=C21)C3=CC=C(C=C3)C=O)C4=CC=C(C=C4)C=O)CC.[I-] |
Computed by PubChem (NCBI)